1,3-benzodioxole-5-glycolic acid structure
|
Common Name | 1,3-benzodioxole-5-glycolic acid | ||
|---|---|---|---|---|
| CAS Number | 27738-46-1 | Molecular Weight | 196.15700 | |
| Density | 1.553g/cm3 | Boiling Point | 403.5ºC at 760mmHg | |
| Molecular Formula | C9H8O5 | Melting Point | 158-162ºC | |
| MSDS | USA | Flash Point | 169.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3,4-methylenedioxymandelic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.553g/cm3 |
|---|---|
| Boiling Point | 403.5ºC at 760mmHg |
| Melting Point | 158-162ºC |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.15700 |
| Flash Point | 169.2ºC |
| Exact Mass | 196.03700 |
| PSA | 75.99000 |
| LogP | 0.53330 |
| Vapour Pressure | 3.1E-07mmHg at 25°C |
| InChIKey | CLUJFRCEPFNVHW-UHFFFAOYSA-N |
| SMILES | O=C(O)C(O)c1ccc2c(c1)OCO2 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Natural products from Cephalotaxus sp.: chemical diversity and synthetic aspects.
Nat. Prod. Rep. 29(8) , 845-69, (2012) The Cephalotaxus genus belongs to the Cephalotaxaceae family of conifers. Over the past decades it has proved to be a fruitful source of interesting natural products, especially alkaloids (cephalotaxi... |
| EINECS 248-628-6 |
| 2-hydroxy-2-(3,4-methylenedioxyphenyl)acetic acid |
| 2-(1,3-benzodioxol-5-yl)-2-hydroxyacetic acid |
| MFCD00043585 |
| 3,4-(methylenedioxy)mandelic acid |
| 2-(3,4-methylenedioxyphenyl)-2-hydroxyacetic acid |
| 2-(2H-benzo[d]1,3-dioxolen-5-yl)-2-hydroxyacetic acid |
| benzo[1,3]dioxol-5-yl-hydroxy-acetic acid |
| 3,4-dioxymethylene mandelic acid |