2-CHLORO-5-(4-CHLOROPHENYL)PYRIMIDINE
Modify Date: 2025-08-25 19:54:07
2-CHLORO-5-(4-CHLOROPHENYL)PYRIMIDINE structure
|
Common Name | 2-CHLORO-5-(4-CHLOROPHENYL)PYRIMIDINE | ||
|---|---|---|---|---|
| CAS Number | 27956-40-7 | Molecular Weight | 225.07400 | |
| Density | 1.363g/cm3 | Boiling Point | 396ºC at 760mmHg | |
| Molecular Formula | C10H6Cl2N2 | Melting Point | 208-212ºC | |
| MSDS | N/A | Flash Point | 225.5ºC | |
| Name | 2-chloro-5-(4-chlorophenyl)pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.363g/cm3 |
|---|---|
| Boiling Point | 396ºC at 760mmHg |
| Melting Point | 208-212ºC |
| Molecular Formula | C10H6Cl2N2 |
| Molecular Weight | 225.07400 |
| Flash Point | 225.5ºC |
| Exact Mass | 223.99100 |
| PSA | 25.78000 |
| LogP | 3.45040 |
| Vapour Pressure | 4.02E-06mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | BQEPTIIJSKEJMX-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-c2cnc(Cl)nc2)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933599090 |
|
~75%
2-CHLORO-5-(4-C... CAS#:27956-40-7 |
| Literature: Colombo, Matteo; Giglio, Marco; Peretto, Ilaria Journal of Heterocyclic Chemistry, 2008 , vol. 45, # 4 p. 1077 - 1081 |
|
~%
2-CHLORO-5-(4-C... CAS#:27956-40-7 |
| Literature: Sui, Zhihua; Guan, Jihua; Macielag, Mark J.; Jiang, Weiqin; Qiu, Yuhong; Kraft, Patricia; Bhattacharjee, Sheela; John, T. Matthew; Craig, Elizabeth; Haynes-Johnson, Donna; Clancy, Joanna Bioorganic and Medicinal Chemistry Letters, 2003 , vol. 13, # 4 p. 761 - 765 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Chlor-5p-chlorphenylpyrimidin |
| 2-chloro-5-p-chlorophenylpyrimidine |
| MFCD03426061 |