diethyl 2-fluoro-2-phenylpropanedioate structure
|
Common Name | diethyl 2-fluoro-2-phenylpropanedioate | ||
|---|---|---|---|---|
| CAS Number | 2802-98-4 | Molecular Weight | 254.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15FO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-fluoro-2-phenylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H15FO4 |
|---|---|
| Molecular Weight | 254.25400 |
| Exact Mass | 254.09500 |
| PSA | 52.60000 |
| LogP | 1.97760 |
| InChIKey | MJGKXSYZACBTDZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(F)(C(=O)OCC)c1ccccc1 |
| Precursor 8 | |
|---|---|
| DownStream 1 | |
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: ULK1_INH_LUMI_1536_1X%INH PRUN
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| diethyl fluoro(phenyl)-malonate |
| fluoro-phenyl-malonic acid diethyl ester |
| diethyl 2-fluoro-2-phenylmalonate |
| 2-fluoro-2-phenyl-malonic acid diethyl ester |
| Propanedioic acid,fluorophenyl-,diethyl ester |
| Fluor-phenyl-malonsaeure-diaethylester |