10-(3-chloropropyl)-2-(trifluoromethyl)phenothiazine
Modify Date: 2025-08-27 16:52:15
10-(3-chloropropyl)-2-(trifluoromethyl)phenothiazine structure
|
Common Name | 10-(3-chloropropyl)-2-(trifluoromethyl)phenothiazine | ||
|---|---|---|---|---|
| CAS Number | 1675-46-3 | Molecular Weight | 343.79400 | |
| Density | 1.345g/cm3 | Boiling Point | 427.8ºC at 760mmHg | |
| Molecular Formula | C16H13ClF3NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.5ºC | |
| Name | 10-(3-chloropropyl)-2-(trifluoromethyl)phenothiazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.345g/cm3 |
|---|---|
| Boiling Point | 427.8ºC at 760mmHg |
| Molecular Formula | C16H13ClF3NS |
| Molecular Weight | 343.79400 |
| Flash Point | 212.5ºC |
| Exact Mass | 343.04100 |
| PSA | 28.54000 |
| LogP | 6.00200 |
| Vapour Pressure | 1.6E-07mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | BZEJZIAESDBOJX-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc2c(c1)N(CCCCl)c1ccccc1S2 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2934999090 |
|
~58%
10-(3-chloropro... CAS#:1675-46-3 |
| Literature: WO2008/27521 A1, ; Page/Page column 55 ; |
|
~%
10-(3-chloropro... CAS#:1675-46-3 |
| Literature: Journal of Pharmaceutical Sciences, , vol. 67, # 2 p. 157 - 162 |
| Precursor 3 | |
|---|---|
| DownStream 8 | |
CAS#:2804-16-2
CAS#:69-23-8
CAS#:16498-21-8![4-methylbenzenesulfonic acid; 10-[3-[4-(2-pyridin-1-ylethyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine structure](https://image.chemsrc.com/caspic/086/66422-02-4.png)
CAS#:66422-02-4
CAS#:83016-35-7![2,6-Piperazinedione,4-[3-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propyl] structure](https://image.chemsrc.com/caspic/473/89507-47-1.png)
CAS#:89507-47-1![3-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxybutan-2-ol structure](https://image.chemsrc.com/caspic/433/40255-60-5.png)
CAS#:40255-60-5![2-[1-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperidin-4-yl]oxyethanol,hydrochloride structure](https://image.chemsrc.com/caspic/364/40255-57-0.png)
CAS#:40255-57-0| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 10-(3-chloropropyl)-2-(trifluoromethyl)-10H-phenothiazine |
| 2-trifluoromethyl-10-(3-chloropropyl)-phenothiazine |
| 10H-Phenothiazine,10-(3-chloropropyl)-2-(trifluoromethyl) |
| 3-(2-trifluoromethyl-10H-phenothiazin-10-yl)propyl chloride |
| 10-(3-chloropropyl)-2-trifluoromethylphenothiazine |