3-(DIFLUOROMETHYL)-1-FLUOROBENZENE
3-(DIFLUOROMETHYL)-1-FLUOROBENZENE structure
|
Common Name | 3-(DIFLUOROMETHYL)-1-FLUOROBENZENE | ||
|---|---|---|---|---|
| CAS Number | 28059-24-7 | Molecular Weight | 235.23600 | |
| Density | 1.252g/cm3 | Boiling Point | 390.2ºC at 760 mmHg | |
| Molecular Formula | C12H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.8ºC | |
Summary: Methyl 5,6-dimethoxy-1H-indole-2-carboxylate (CAS number: 28059-24-7) is a compound with molecular formula C12H13NO4 and molecular weight 235.24. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 5,6-dimethoxy-1H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 390.2ºC at 760 mmHg |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.23600 |
| Flash Point | 189.8ºC |
| Exact Mass | 235.08400 |
| PSA | 60.55000 |
| LogP | 1.97170 |
| Vapour Pressure | 2.69E-06mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | SBCKSKZNFJUHAQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2cc(OC)c(OC)cc2[nH]1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| methyl 5,6-dimethoxy-1h-indole-2-carboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Methyl 5,6-dimethoxy-1H-indole-2-carboxylate? |
| A: CAS number of Methyl 5,6-dimethoxy-1H-indole-2-carboxylate is 28059-24-7. |
| Q: What English synonyms does Methyl 5,6-dimethoxy-1H-indole-2-carboxylate have? |
| A: English synonyms of Methyl 5,6-dimethoxy-1H-indole-2-carboxylate: methyl 5,6-dimethoxy-1h-indole-2-carboxylate. |
| Q: What is the LogP of Methyl 5,6-dimethoxy-1H-indole-2-carboxylate? |
| A: LogP of Methyl 5,6-dimethoxy-1H-indole-2-carboxylate is 1.97170. |
| Q: What is the boiling point of Methyl 5,6-dimethoxy-1H-indole-2-carboxylate? |
| A: Boiling point of Methyl 5,6-dimethoxy-1H-indole-2-carboxylate is 390.2ºC at 760 mmHg. |
| Q: What is the molecular weight of Methyl 5,6-dimethoxy-1H-indole-2-carboxylate? |
| A: Molecular weight of Methyl 5,6-dimethoxy-1H-indole-2-carboxylate is 235.23600. |
| Q: What is the molecular formula of Methyl 5,6-dimethoxy-1H-indole-2-carboxylate? |
| A: Molecular formula of Methyl 5,6-dimethoxy-1H-indole-2-carboxylate is C12H13NO4. |
| Q: What is the English name of Methyl 5,6-dimethoxy-1H-indole-2-carboxylate? |
| A: The English name of Methyl 5,6-dimethoxy-1H-indole-2-carboxylate is Methyl 5,6-dimethoxy-1H-indole-2-carboxylate. |
| Q: What is the polar surface area (PSA) of Methyl 5,6-dimethoxy-1H-indole-2-carboxylate? |
| A: Polar surface area (PSA) of Methyl 5,6-dimethoxy-1H-indole-2-carboxylate is 60.55000. |
| Q: What is the InChIKey of Methyl 5,6-dimethoxy-1H-indole-2-carboxylate? |
| A: InChIKey of Methyl 5,6-dimethoxy-1H-indole-2-carboxylate is SBCKSKZNFJUHAQ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Methyl 5,6-dimethoxy-1H-indole-2-carboxylate? |
| A: SMILES notation of Methyl 5,6-dimethoxy-1H-indole-2-carboxylate is COC(=O)c1cc2cc(OC)c(OC)cc2[nH]1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |