6-Nitroveratraldehyde structure
|
Common Name | 6-Nitroveratraldehyde | ||
|---|---|---|---|---|
| CAS Number | 20357-25-9 | Molecular Weight | 211.17100 | |
| Density | 1.312 g/cm3 | Boiling Point | 390.8ºC at 760 mmHg | |
| Molecular Formula | C9H9NO5 | Melting Point | 133.2-134.5 °C | |
| MSDS | USA | Flash Point | 194.3ºC | |
Use of 6-NitroveratraldehydeDMNB (6-Nitroveratraldehyde), a precursor, can be used for the synthesis no-carrier-added 6-[18F]fluoro-L-DOPA (6-FDOPA). No-Carrier-Added (NCA) 6-[18F]fluoro-L-dopa (6-FDOPA) is being produced routinely for PET investigations of dopaminergic systems[1]. |
| Name | 4,5-dimethoxy-2-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Description | DMNB (6-Nitroveratraldehyde), a precursor, can be used for the synthesis no-carrier-added 6-[18F]fluoro-L-DOPA (6-FDOPA). No-Carrier-Added (NCA) 6-[18F]fluoro-L-dopa (6-FDOPA) is being produced routinely for PET investigations of dopaminergic systems[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.312 g/cm3 |
|---|---|
| Boiling Point | 390.8ºC at 760 mmHg |
| Melting Point | 133.2-134.5 °C |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17100 |
| Flash Point | 194.3ºC |
| Exact Mass | 211.04800 |
| PSA | 81.35000 |
| LogP | 1.94770 |
| Vapour Pressure | 2.59E-06mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | YWSPWKXREVSQCA-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)c([N+](=O)[O-])cc1OC |
| Storage condition | 2-8°C |
| Water Solubility | DMSO: 22 mg/mL |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Safety Phrases | S24/25 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | GY8410000 |
| HS Code | 2913000090 |
| Precursor 7 | |
|---|---|
| DownStream 10 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
|
An improved synthesis of no-carrier-added (NCA) 6-[18 F] Fluoro-l-DOPA and its remote routine production for PET investigations of dopaminergic systems. Reddy GN, et al.
Appl. Radiat. Isot. 44(4) , 645-49, (1993)
|
|
|
o-Nitroaryl-bis (5-methylfur-2-yl) methanes as Versatile Synthons for the Synthesis of Nitrogen-Containing Heterocycles. Butin AV, et al.
Molecules 2(4) , 62-8, (1997)
|
| 4,5-dimethoxy-2-nitro-benzaldehyde |
| Benzaldehyde,4,5-dimethoxy-2-nitro |
| 3,4-Dimethoxy-6-nitrobenzaldehyde |
| 6-Nitroveratraldehyde |
| 2-nitro-4,5-dimethoxybenzaldehyde |
| DNA-Dependent Protein Kinase Inhibitor |
| DMNB |
| EINECS 243-762-1 |
| MFCD00007134 |
| DNA-PK Inhibitor |