Benzene,1,2-dimethoxy-3-(2-nitroethenyl)- structure
|
Common Name | Benzene,1,2-dimethoxy-3-(2-nitroethenyl)- | ||
|---|---|---|---|---|
| CAS Number | 2815-67-0 | Molecular Weight | 209.19900 | |
| Density | 1.197g/cm3 | Boiling Point | 328.3ºC at 760mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | 80-84ºC(lit.) | |
| MSDS | N/A | Flash Point | 148.2ºC | |
| Name | 1,2-dimethoxy-3-(2-nitrovinyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 328.3ºC at 760mmHg |
| Melting Point | 80-84ºC(lit.) |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 148.2ºC |
| Exact Mass | 209.06900 |
| PSA | 64.28000 |
| LogP | 2.47440 |
| Vapour Pressure | 0.000366mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | OFJZSDMKKDTNHZ-VOTSOKGWSA-N |
| SMILES | COc1cccc(C=C[N+](=O)[O-])c1OC |
| Hazard Codes | Xi,N |
|---|---|
| Risk Phrases | 36-50/53 |
| Safety Phrases | 26-36-60-61 |
| RIDADR | UN 3077 9/PG 3 |
|
~93%
Benzene,1,2-dim... CAS#:2815-67-0 |
| Literature: Alizadeh, Abdolhamid; Khodaei, Mohammad M.; Eshghi, Ali Journal of Organic Chemistry, 2010 , vol. 75, # 23 p. 8295 - 8298 |
|
~%
Benzene,1,2-dim... CAS#:2815-67-0 |
| Literature: Luzzio, Frederick A.; Wlodarczyk, Marek T.; Duveau, Damien Y.; Chen, Juan Tetrahedron Letters, 2007 , vol. 48, # 38 p. 6704 - 6708 |
| 2,3-dimethoxynitrostyrene |
| 2,3-DIMETHOXY-W-NITROSTYRENE |