Benzene,1,2-dimethoxy-3,4,5-trinitro- structure
|
Common Name | Benzene,1,2-dimethoxy-3,4,5-trinitro- | ||
|---|---|---|---|---|
| CAS Number | 17418-07-4 | Molecular Weight | 273.15600 | |
| Density | 1.579g/cm3 | Boiling Point | 499ºC at 760mmHg | |
| Molecular Formula | C8H7N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.1ºC | |
| Name | 1,2-dimethoxy-3,4,5-trinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.579g/cm3 |
|---|---|
| Boiling Point | 499ºC at 760mmHg |
| Molecular Formula | C8H7N3O8 |
| Molecular Weight | 273.15600 |
| Flash Point | 249.1ºC |
| Exact Mass | 273.02300 |
| PSA | 155.92000 |
| LogP | 2.99800 |
| Vapour Pressure | 1.33E-09mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | NZXYYWMLCFKCPV-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c1OC |
| HS Code | 2909309090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3.4.5-Trinitro-brenzcatechin-dimethylaether |
| 3.4.5-Trinitro-veratrol |
| 1,2-dimethoxy-3,4,5-trinitro-benzene |
| 1,2-Dimethoxy-3,4,5-trinitro-benzol |
| Benzene,1,2-dimethoxy-3,4,5-trinitro |
| 1,2,3-Trinitro-4,5-dimethoxy-benzol |