4-[(E)-2-(4-bromophenyl)ethenyl]-N,N-dimethyl-aniline structure
|
Common Name | 4-[(E)-2-(4-bromophenyl)ethenyl]-N,N-dimethyl-aniline | ||
|---|---|---|---|---|
| CAS Number | 2844-19-1 | Molecular Weight | 302.20900 | |
| Density | 1.332g/cm3 | Boiling Point | 411ºC at 760 mmHg | |
| Molecular Formula | C16H16BrN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.3ºC | |
| Name | 4-[2-(4-bromophenyl)ethenyl]-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.332g/cm3 |
|---|---|
| Boiling Point | 411ºC at 760 mmHg |
| Molecular Formula | C16H16BrN |
| Molecular Weight | 302.20900 |
| Flash Point | 202.3ºC |
| Exact Mass | 301.04700 |
| PSA | 3.24000 |
| LogP | 4.68550 |
| Vapour Pressure | 5.79E-07mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | OJAOHXMMLZIIOY-ONEGZZNKSA-N |
| SMILES | CN(C)c1ccc(C=Cc2ccc(Br)cc2)cc1 |
| HS Code | 2921420090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-[(E)-2-(4-BROMOPHENYL)VINYL]-N,N-DIMETHYL-ANILINE |
| 4-[(E)-2-(4-bromophenyl)ethenyl]-N,N-dimethylbenzenamine |
| 4,4'-dimethylaminobromo-(E)-stilbene |
| (4'-bromo-trans-stilben-4-yl)-dimethyl-amine |
| 4-dimethylamino-4'-bromo-stilbene |
| (E)-4-bromo-4'-dimethylamino-stilbene |
| 1-(4-bromophenyl)-2-(4-dimethylaminophenyl)ethene |
| Benzenamine,4-[2-(4-bromophenyl)ethenyl]-N,N-dimethyl |
| (4'-Brom-trans-stilben-4-yl)-dimethyl-amin |