erythristemine structure
|
Common Name | erythristemine | ||
|---|---|---|---|---|
| CAS Number | 28619-41-2 | Molecular Weight | 343.42 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 494.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.9±25.9 °C | |
Use of erythristemineErythristemine is an alkaloid that can be isolated from Erythrina lysistemon. Erythristemine has weak DPPH radical scavenging properties[1]. |
| Name | (3α,11β)-3,11,15,16-Tetramethoxy-1,2,6,7-tetradehydroerythri |
|---|---|
| Synonym | More Synonyms |
| Description | Erythristemine is an alkaloid that can be isolated from Erythrina lysistemon. Erythristemine has weak DPPH radical scavenging properties[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 494.9±45.0 °C at 760 mmHg |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 |
| Flash Point | 144.9±25.9 °C |
| Exact Mass | 343.178345 |
| PSA | 40.16000 |
| LogP | 1.75 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | IUMRZRWBQPPMSS-DZJIEVIWSA-N |
| SMILES | COc1cc2c(cc1OC)C13CC(OC)C=CC1=CCN3CC2OC |
| Hazard Codes | Xi |
|---|
| (3α,11β)-3,11,15,16-Tetramethoxy-1,2,6,7-tetradehydroerythrinan |
| Erythrinan, 1,2,6,7-tetradehydro-3,11,15,16-tetramethoxy-, (3α,11β)- |
| Eremofortin B |