4-(4-Trifluoromethoxyphenoxy)piperidine structure
|
Common Name | 4-(4-Trifluoromethoxyphenoxy)piperidine | ||
|---|---|---|---|---|
| CAS Number | 287952-67-4 | Molecular Weight | 261.240 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 292.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C12H14F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.5±27.3 °C | |
| Name | 4-[4-(trifluoromethoxy)phenoxy]piperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 292.2±40.0 °C at 760 mmHg |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.240 |
| Flash Point | 130.5±27.3 °C |
| Exact Mass | 261.097656 |
| PSA | 30.49000 |
| LogP | 3.12 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.475 |
| InChIKey | RPQOTFPZKNHYFB-UHFFFAOYSA-N |
| SMILES | FC(F)(F)Oc1ccc(OC2CCNCC2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| Precursor 7 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-[4-(Trifluoromethoxy)phenoxy]piperidine HCl |
| MFCD06656166 |
| Piperidine, 4-[4-(trifluoromethoxy)phenoxy]- |
| 4-[4-(Trifluoromethoxy)phenoxy]piperidine |
| 4-(4-Trifluoromethoxyphenoxy)piperidine |