L-Aspartic acid dibenzyl ester 4-toluenesulfonate structure
|
Common Name | L-Aspartic acid dibenzyl ester 4-toluenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 2886-33-1 | Molecular Weight | 485.549 | |
| Density | N/A | Boiling Point | 455.3ºC at 760 mmHg | |
| Molecular Formula | C25H27NO7S | Melting Point | 157-160 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of L-Aspartic acid dibenzyl ester 4-toluenesulfonateH-Asp(OBzl)-Obzl.TosOH is an aspartic acid derivative[1]. |
| Name | L-Aspartic acid dibenzyl ester 4-toluenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | H-Asp(OBzl)-Obzl.TosOH is an aspartic acid derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Boiling Point | 455.3ºC at 760 mmHg |
|---|---|
| Melting Point | 157-160 °C(lit.) |
| Molecular Formula | C25H27NO7S |
| Molecular Weight | 485.549 |
| Exact Mass | 485.150818 |
| PSA | 141.37000 |
| LogP | 5.21340 |
| Vapour Pressure | 1.78E-08mmHg at 25°C |
| InChIKey | HLMUYZYLPUHSNV-NTISSMGPSA-N |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NC(CC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~95%
L-Aspartic acid... CAS#:2886-33-1 |
| Literature: Bergmeier, Stephen C.; Cobas, Agustin A.; Rapoport, Henry Journal of Organic Chemistry, 1993 , vol. 58, # 9 p. 2369 - 2376 |
| Precursor 3 | |
|---|---|
| DownStream 8 | |
| L-Aspartic acid, bis(phenylmethyl) ester, 4-methylbenzenesulfonate |
| TosOH |
| L-aspartic acid dibenzyl ester p-toluenesulfonate salt |
| H-Asp(OBzl)-OBzl·Tos-OH |
| 1,4-Dibenzyl L-Aspartate p-Toluenesulfonate |
| MFCD00065188 |
| L-Aspartic acid dibenzyl ester p-toluenesulfonate |
| EINECS 220-746-2 |
| L-Aspartic Acid 1,4-Dibenzyl Ester p-Toluenesulfonate |
| L-Aspartic acid, bis(phenylmethyl) ester, 4-methylbenzenesulfonate (1:1) |
| H-Asp(OBzl)-OBzl |
| H-Asp(Obzl)-Obzl TosOH |
| L-Aspartic acid dibe |
| L-Asp-maleinimide |
| L-aspatic acid dibenzyl ester toluene-p-sulfonate salt |
| Dibenzyl L-aspartate 4-methylbenzenesulfonate |
| Dibenzyl L-aspartate 4-methylbenzenesulfonate (1:1) |
| (S)-Dibenzyl 2-aminosuccinate 4-methylbenzenesulfonate |
| H-Asp(OBzl)-OBzl·TosOH |