2-Fluoro-4-isopropoxybenzoic acid structure
|
Common Name | 2-Fluoro-4-isopropoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 289039-81-2 | Molecular Weight | 198.191 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 281.1±20.0 °C at 760 mmHg | |
| Molecular Formula | C10H11FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.8±21.8 °C | |
| Name | 2-fluoro-4-propan-2-yloxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 281.1±20.0 °C at 760 mmHg |
| Molecular Formula | C10H11FO3 |
| Molecular Weight | 198.191 |
| Flash Point | 123.8±21.8 °C |
| Exact Mass | 198.069229 |
| PSA | 46.53000 |
| LogP | 2.85 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | LFYMPARUPZDGHJ-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1ccc(C(=O)O)c(F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-fluoro-4-(methylethoxy)benzoic acid |
| 2-Fluoro-4-isopropoxybenzoic acid |
| 2-Fluoro-4-iso-propyloxybenzoic acid |
| PC8854 |
| Benzoic acid, 2-fluoro-4-(1-methylethoxy)- |