2-Amino-4'-Chlorobenzophenone structure
|
Common Name | 2-Amino-4'-Chlorobenzophenone | ||
|---|---|---|---|---|
| CAS Number | 2894-51-1 | Molecular Weight | 231.678 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 419.8±30.0 °C at 760 mmHg | |
| Molecular Formula | C13H10ClNO | Melting Point | 103°C | |
| MSDS | N/A | Flash Point | 207.7±24.6 °C | |
| Name | (2-aminophenyl)-(4-chlorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 419.8±30.0 °C at 760 mmHg |
| Melting Point | 103°C |
| Molecular Formula | C13H10ClNO |
| Molecular Weight | 231.678 |
| Flash Point | 207.7±24.6 °C |
| Exact Mass | 231.045090 |
| PSA | 43.09000 |
| LogP | 3.22 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | APHLSUBLNQBFTM-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1C(=O)c1ccc(Cl)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RTECS | XZ1900000 |
| HS Code | 2922399090 |
| Precursor 8 | |
|---|---|
| DownStream 9 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00025193 |
| EINECS 220-770-3 |
| (2-Aminophenyl)(4-chlorophenyl)methanone |
| Methanone, (2-aminophenyl)(4-chlorophenyl)- |
| 2-Amino-4'-Chlorobenzophenone |