[(2,6-Dimethylphenyl)amino](oxo)acetic acid structure
|
Common Name | [(2,6-Dimethylphenyl)amino](oxo)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 2903-48-2 | Molecular Weight | 193.199 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H11NO3 | Melting Point | 173°C (分解) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(2,6-dimethylanilino)-2-oxo-acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Melting Point | 173°C (分解) |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.199 |
| Exact Mass | 193.073898 |
| PSA | 66.40000 |
| LogP | 1.43 |
| Index of Refraction | 1.608 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Precautionary Statements | P301 + P312 + P330 |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
|
~%
[(2,6-Dimethylp... CAS#:2903-48-2 |
| Literature: Ferrando-Soria, Jesaus; Pardo, Emilio; Ruiz-Garcia, Rafael; Cano, Joan; Lloret, Francisco; Julve, Miguel; Journaux, Yves; Pasan, Jorge; Ruiz-Perez, Catalina Chemistry - A European Journal, 2011 , vol. 17, # 7 p. 2176 - 2188 |
| [(2,6-Dimethylphenyl)amino](oxo)acetic acid |
| 2-(2,6-dimethylphenylamino)-2-oxoacetic acid |
| 2,6-Dimethyl-oxanilsaeure [Oxalsaeure-(2,6-anilid)] |
| 2,4,6-Octatriene,2,6-dimethyl-,(E,Z) |
| triene neo-alloocimene |
| InChI=1/C10H16/c1-5-10(4)8-6-7-9(2)3/h5-8H,1-4H3/b8-6+,10-5 |
| N-(2,6-Dimethylphenyl)oxamic Acid |
| (E,Z)-2,6-Dimethylocta-2,4,6-triene |
| Acetic acid, 2-[(2,6-dimethylphenyl)amino]-2-oxo- |
| 2,6-dimethyl-2,trans-4,cis-6-octatriene |
| cis-allocimene |
| trans-allo-ocimene |
| 2,6-dimethyloctatriene-2,trans-4,trans-6 |
| GQVMHMFBVWSSPF-DAIHKBMKSA |
| (4E,6Z)-2,6-Dimethyl-2,4,6-octatriene |
| 4E,6Z-allo-ocimene |