1-Bromo-2,3,4,5-tetramethoxy-6-methylbenzene structure
|
Common Name | 1-Bromo-2,3,4,5-tetramethoxy-6-methylbenzene | ||
|---|---|---|---|---|
| CAS Number | 73875-27-1 | Molecular Weight | 291.138 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 317.0±37.0 °C at 760 mmHg | |
| Molecular Formula | C11H15BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.0±25.0 °C | |
| Name | 1-bromo-2,3,4,5-tetramethoxy-6-methylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 317.0±37.0 °C at 760 mmHg |
| Molecular Formula | C11H15BrO4 |
| Molecular Weight | 291.138 |
| Flash Point | 128.0±25.0 °C |
| Exact Mass | 290.015350 |
| PSA | 36.92000 |
| LogP | 2.94 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | FQPOTLCIUAYGPN-UHFFFAOYSA-N |
| SMILES | COc1c(C)c(Br)c(OC)c(OC)c1OC |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2909309090 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-bromo-2-methyl-3,4,5,6-tetramethoxybenzene |
| 1,2,3,4-tetramethoxy-5-methyl-6-bromobenzene |
| 2,3,4,5-tetramethoxy-6-methyl bromo benzene |
| 2,3,4,5-tetramethoxy-6-methyl-1-bromobenzene |
| Benzene, 1-bromo-2,3,4,5-tetramethoxy-6-methyl- |
| 2-methyl-3,4,5,6-tetramethoxybromobenzene |
| 2-bromo-3,4,5,6-tetramethoxytoluene |
| 1-Bromo-2,3,4,5-tetramethoxy-6-methylbenzene |
| MFCD08458461 |