3,5-dimethylbenzenesulfonyl chloride structure
|
Common Name | 3,5-dimethylbenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 2905-27-3 | Molecular Weight | 204.67400 | |
| Density | 1.29g/cm3 | Boiling Point | 302.3ºC at 760 mmHg | |
| Molecular Formula | C8H9ClO2S | Melting Point | 90-94 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 136.6ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 3,5-dimethylbenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 302.3ºC at 760 mmHg |
| Melting Point | 90-94 °C(lit.) |
| Molecular Formula | C8H9ClO2S |
| Molecular Weight | 204.67400 |
| Flash Point | 136.6ºC |
| Exact Mass | 204.00100 |
| PSA | 42.52000 |
| LogP | 3.31170 |
| Vapour Pressure | 0.00179mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | LSAGRAXLOLZVKO-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(S(=O)(=O)Cl)c1 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45-S39-S37-S36-SA26 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Complexes possessing rare "tertiary" sulfonamide nitrogen-to-metal bonds of normal length: fac-[Re(CO)3(N(SO2R)dien)]PF6 complexes with hydrophilic sulfonamide ligands.
Inorg. Chem. 53(2) , 1144-55, (2014) Tertiary sulfonamide nitrogen-to-metal bonds of normal length are very rare. We recently discovered such a bond in one class of fac-[Re(CO)3(N(SO2R)(CH2Z)2)](n) complexes (Z = 2-pyridyl) with N(SO2R)d... |
|
|
Structure of hexa-2, 4-diyne-1, 6-diyl bis (3, 5-dimethylbenzenesulfonate). Barrow MJ, et al.
Acta Crystallogr. C Struct. Chem. 45(11) , 1821-1822., (1989)
|
| 3,5-Dimethylbenzenesulphonyl chloride |
| MFCD03094655 |
| 5-(Chlorosulphonyl)-m-xylene |
| 3,5-dimethylbenzene-1-sulphonyl chloride |
| 3,5-Dimethylbenzenesulfonyl chloride |
| (3,5-dimethylphenyl)chlorosulfone |
| m-Xylol-sulfonsaeure-(5)-chlorid |
| 3,5-Dimethyl-benzolsulfonylchlorid |
| 3,5-dimethylbenzene-1-sulfonyl chloride |
| 3,5-dimethyl-benzenesulfonyl chloride |
| 1.3-Dimethyl-benzol-sulfonsaeure-(5)-chlorid |
| 3,5-dimethylbenzensulphonyl chloride |