dinitramine structure
|
Common Name | dinitramine | ||
|---|---|---|---|---|
| CAS Number | 29091-05-2 | Molecular Weight | 322.24100 | |
| Density | 1.465g/cm3 | Boiling Point | 409.1ºC at 760mmHg | |
| Molecular Formula | C11H13F3N4O4 | Melting Point | 98-99ºC | |
| MSDS | Chinese USA | Flash Point | 201.2ºC | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | dinitramine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.465g/cm3 |
|---|---|
| Boiling Point | 409.1ºC at 760mmHg |
| Melting Point | 98-99ºC |
| Molecular Formula | C11H13F3N4O4 |
| Molecular Weight | 322.24100 |
| Flash Point | 201.2ºC |
| Exact Mass | 322.08900 |
| PSA | 120.90000 |
| LogP | 4.57780 |
| Index of Refraction | 1.474 |
| InChIKey | OFDYMSKSGFSLLM-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1c([N+](=O)[O-])cc(C(F)(F)F)c(N)c1[N+](=O)[O-] |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H312-H400 |
| Precautionary Statements | P273-P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
| Risk Phrases | R21;R50/53 |
| Safety Phrases | S60;S61;S36/S37 |
| RIDADR | UN 3077 |
| RTECS | XS9990000 |
| HS Code | 2921519011 |
| HS Code | 2921519011 |
|---|---|
| Summary | 2921519011 n1,n1-diethyl-2,6-dinitro-4-(trifluoromethyl)benzene-1,3-diamine。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:30.0% |
|
Insights into the formation and degradation mechanisms of methylenedinitramine during the incubation of RDX with anaerobic sludge.
Environ. Sci. Technol. 36(4) , 633-8, (2002) In an earlier study, we reported that hexahydro-1,3,5-trinitro-1,3,5-triazine (RDX) biodegraded with domestic anaerobic sludge to produce a key RDX ring cleavage intermediate that was tentatively iden... |
|
|
High-performance liquid chromatographic determination of dinitroaniline herbicides in soil and water.
J. Chromatogr. A. 585(1) , 164-7, (1991) A high-performance liquid chromatographic method for the simultaneous determination of the dinitroaniline herbicides dinitramine, ethalfluralin, trifluralin, pendimethalin and isopropalin in soil and ... |
|
|
Mechanism of xanthine oxidase catalyzed biotransformation of HMX under anaerobic conditions.
Biochem. Biophys. Res. Commun. 306(2) , 509-15, (2003) Enzyme catalyzed biotransformation of the energetic chemical octahydro-1,3,5,7-tetranitro-1,3,5,7-tetrazocine (HMX) is not known. The present study describes a xanthine oxidase (XO) catalyzed biotrans... |
| Caswell No. 335C |
| EINECS 249-419-2 |
| 3-N,3-N-diethyl-2,4-dinitro-6-(trifluoromethyl)benzene-1,3-diamine |
| Cobex (herbicide) |
| 3-Diethylamino-2,4-dinitro-6-trifluoromethylaniline |
| 2-amino-3,5-dinitro-4-diethylaminobenzotrifluoride |
| MFCD00144149 |
| Cobeko |
| N,N-diethyl-2,6-dinitro-4-trifluoromethyl-m-phenylenediamine |
| N1,N1-diethyl-2,6-dinitro-4-(trifluoromethyl)benzene-1,3-diamine |
| N1,N1-diethyl-2,6-dinitro-4-trifluoromethyl-m-phenylenediamine |
| N1,N1-diethyl-2,6-dinitro-4-(trifluoromethyl)-1,3-benzenediamine |
| Cobexo |
| Dinitramine [ANSI:BSI:ISO] |
| USB-3584 |