3-chloro-N,N-diethyl-2,6-dinitro-4-(trifluoromethyl)aniline structure
|
Common Name | 3-chloro-N,N-diethyl-2,6-dinitro-4-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 36438-51-4 | Molecular Weight | 341.67100 | |
| Density | 1.488g/cm3 | Boiling Point | 388.2ºC at 760mmHg | |
| Molecular Formula | C11H11ClF3N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.5ºC | |
| Name | 3-chloro-N,N-diethyl-2,6-dinitro-4-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.488g/cm3 |
|---|---|
| Boiling Point | 388.2ºC at 760mmHg |
| Molecular Formula | C11H11ClF3N3O4 |
| Molecular Weight | 341.67100 |
| Flash Point | 188.5ºC |
| Exact Mass | 341.03900 |
| PSA | 94.88000 |
| LogP | 5.06780 |
| Index of Refraction | 1.546 |
| InChIKey | USJZRMMIXCKQRV-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1c([N+](=O)[O-])cc(C(F)(F)F)c(Cl)c1[N+](=O)[O-] |
| HS Code | 2921420090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,4-dinitro-3-diethylamino-6-trifluoromethylchlorobenzene |
| 3-chloro-N,N-diethyl-2,6-dinitro-4-trifluoromethylaniline |
| 4-trifluoromethyl-2,6-dinitro-3-chloro-N,N-diethylaniline |
| 2-Chloro-4-diethylamino-3,5-dinitrotrifluoromethylbenzene |
| 2-chloro-4-diethylamino-3,5-dinitrobenzotrifluoride |
| N,n-diethyl-3-chloro-2,6-dinitro-4-trifluoromethylaniline |
| 3-Chloro-N,N-diethyl-2,6-dinitro-4-(trifluoromethyl)benzenamine |