2-Hydroxy-3-nitrobenzamide structure
|
Common Name | 2-Hydroxy-3-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 2912-76-7 | Molecular Weight | 182.13400 | |
| Density | 1.538g/cm3 | Boiling Point | 283.1ºC at 760 mmHg | |
| Molecular Formula | C7H6N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125ºC | |
| Name | 2-Hydroxy-3-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.538g/cm3 |
|---|---|
| Boiling Point | 283.1ºC at 760 mmHg |
| Molecular Formula | C7H6N2O4 |
| Molecular Weight | 182.13400 |
| Flash Point | 125ºC |
| Exact Mass | 182.03300 |
| PSA | 109.14000 |
| LogP | 1.62280 |
| Vapour Pressure | 0.00189mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | FECMDSYYFNKSJZ-UHFFFAOYSA-N |
| SMILES | NC(=O)c1cccc([N+](=O)[O-])c1O |
| HS Code | 2924299090 |
|---|
|
~95%
2-Hydroxy-3-nit... CAS#:2912-76-7 |
| Literature: Tauer, Erich Synthesis, 2002 , # 6 p. 723 - 725 |
|
~76%
2-Hydroxy-3-nit... CAS#:2912-76-7 |
| Literature: Meshram; Ganesh; Madhavi; Eshwaraiah; Yadav; Gunasekar Synthetic Communications, 2003 , vol. 33, # 14 p. 2497 - 2503 |
|
~%
2-Hydroxy-3-nit... CAS#:2912-76-7 |
| Literature: Huebner Justus Liebigs Annalen der Chemie, 1879 , vol. 195, p. 37 |
|
~%
2-Hydroxy-3-nit... CAS#:2912-76-7 |
| Literature: Huebner Justus Liebigs Annalen der Chemie, 1879 , vol. 195, p. 37 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-nitrosalicylamide |
| Benzamide,2-hydroxy-3-nitro |
| 3-Nitro-salicoylamide |
| 2-hydroxy-3-nitro-benzoic acid amide |
| 2-Hydroxy-3-nitro-benzoesaeure-amid |
| 3-Nitro-salicylsaeure-amid |