Prephenic acid barium salt structure
|
Common Name | Prephenic acid barium salt | ||
|---|---|---|---|---|
| CAS Number | 2931-08-0 | Molecular Weight | 361.49400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8BaO6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Prephenic acid barium salt |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8BaO6 |
|---|---|
| Molecular Weight | 361.49400 |
| Exact Mass | 361.93700 |
| PSA | 117.56000 |
| InChIKey | XXHDQWSGCJPALI-UHFFFAOYSA-L |
| SMILES | O=C([O-])C(=O)CC1(C(=O)[O-])C=CC(O)C=C1.[Ba+2] |
| Storage condition | 20°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H332 |
| Precautionary Statements | P261-P301 + P312 + P330 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | Xn |
| Risk Phrases | 20/22 |
| RIDADR | NONH for all modes of transport |
|
The usefulness of biotyping in the determination of selected pathogenicity determinants in Streptococcus mutans.
BMC Microbiol. 14 , 194, (2014) Streptococcus mutans is known to be a primary etiological factor of dental caries, a widespread and growing disease in Polish children. Recognition of novel features determining the pathogenicity of t... |
| prephenic acid barium |
| (1-Carboxy-4t-hydroxy-cyclohexa-2,5-dien-r-yl)-brenztraubensaeure,Barium-Salz |
| (1-carboxy-4t-hydroxy-cyclohexa-2,5-dien-r-yl)-pyruvic acid,barium salt |
| barium prephenate |