Disiloxane,1,3-bis(iodomethyl)-1,1,3,3-tetramethyl- structure
|
Common Name | Disiloxane,1,3-bis(iodomethyl)-1,1,3,3-tetramethyl- | ||
|---|---|---|---|---|
| CAS Number | 2943-69-3 | Molecular Weight | 414.17100 | |
| Density | 1.703g/cm3 | Boiling Point | 226.6ºC at 760mmHg | |
| Molecular Formula | C6H16I2OSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 90.8ºC | |
| Name | iodomethyl-[iodomethyl(dimethyl)silyl]oxy-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.703g/cm3 |
|---|---|
| Boiling Point | 226.6ºC at 760mmHg |
| Molecular Formula | C6H16I2OSi2 |
| Molecular Weight | 414.17100 |
| Flash Point | 90.8ºC |
| Exact Mass | 413.88300 |
| PSA | 9.23000 |
| LogP | 4.19820 |
| Vapour Pressure | 0.122mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | AYFZKJFGMZOAKS-UHFFFAOYSA-N |
| SMILES | C[Si](C)(CI)O[Si](C)(C)CI |
| Hazard Codes | T+ |
|---|---|
| Risk Phrases | 36/38 |
| Safety Phrases | 24/25-36/37/39 |
| HS Code | 2934999090 |
|
~94%
Disiloxane,1,3-... CAS#:2943-69-3 |
| Literature: Lee, Soonho; Jeon, Youngtae; Lim, Youngdon; Cho, Younggil; Lee, Sangyoung; Kim, Whangi Bulletin of the Korean Chemical Society, 2013 , vol. 34, # 9 p. 2583 - 2588 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,1,2,2-Tetramethyl-1,2-bis-chlormethyl-disiloxan |
| 1,3-bis(iodomethyl) tetramethyldisiloxane |
| 1,3-bis-iodomethyl-1,1,3,3-tetramethyl-disiloxane |
| Bis-(dimethyljodmethyl)-disiloxan |