tert-Butyl 2-chloroisonicotinate structure
|
Common Name | tert-Butyl 2-chloroisonicotinate | ||
|---|---|---|---|---|
| CAS Number | 295349-62-1 | Molecular Weight | 213.661 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 287.4±20.0 °C at 760 mmHg | |
| Molecular Formula | C10H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.6±21.8 °C | |
| Name | tert-butyl 2-chloropyridine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 287.4±20.0 °C at 760 mmHg |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.661 |
| Flash Point | 127.6±21.8 °C |
| Exact Mass | 213.055649 |
| PSA | 39.19000 |
| LogP | 2.84 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | FPUSSPQEUANTGI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1ccnc(Cl)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~%
tert-Butyl 2-ch... CAS#:295349-62-1 |
| Literature: WO2008/11499 A1, ; Page/Page column 37 ; |
|
~57%
tert-Butyl 2-ch... CAS#:295349-62-1 |
| Literature: Betschart, Claudia; Lerchner, Andreas; Machauer, Rainer; Rueger, Heinrich; Tintelnot-Blomley, Marina; Veenstra, Siem Jacob Patent: US2008/132477 A1, 2008 ; Location in patent: Page/Page column 28 ; |
|
~%
tert-Butyl 2-ch... CAS#:295349-62-1 |
| Literature: US6548514 B1, ; US 6548514 B1 |
|
~%
tert-Butyl 2-ch... CAS#:295349-62-1 |
| Literature: WO2007/75896 A2, ; Page/Page column 132 ; |
|
~%
tert-Butyl 2-ch... CAS#:295349-62-1 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 21, # 14 p. 4233 - 4249 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-chloroisonicotinic acid tert-butyl ester |
| 2-Methyl-2-propanyl 2-chloroisonicotinate |
| 2-Chloropyridine-4-carboxylic acid tert-butyl ester |
| 4-Pyridinecarboxylic acid, 2-chloro-, 1,1-dimethylethyl ester |
| tert.-butyl 2-chloroisonicotinoate |
| tert-Butyl 2-chloropyridine-4-carboxylate |
| 2-Chloro-4-pyridinecarboxylic acid 1,1-dimethylethyl ester |
| MFCD03411667 |
| 2-Chloro-4-pyridinecarboxylicacid1,1-dimethylethylester |
| tert-Butyl 2-chloroisonicotinate |
| 2-Chloro-4-pyridinecaroboxylicacidmethylester |
| tert-Butyl-2-chlorpyridin-4-carboxylat |