Ursocholic acid structure
|
Common Name | Ursocholic acid | ||
|---|---|---|---|---|
| CAS Number | 2955-27-3 | Molecular Weight | 408.57100 | |
| Density | 1.184g/cm3 | Boiling Point | 583.9ºC at 760mmHg | |
| Molecular Formula | C24H40O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 321ºC | |
Use of Ursocholic acidUrsocholic acid, a bile acid found predominantly in bile of mammals, is an inhibitor of 7α-hydroxysteroid dehydrogenase and hepatocyte nuclear factor 1α. |
| Name | Ursocholic Acid |
|---|---|
| Synonym | More Synonyms |
| Description | Ursocholic acid, a bile acid found predominantly in bile of mammals, is an inhibitor of 7α-hydroxysteroid dehydrogenase and hepatocyte nuclear factor 1α. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Density | 1.184g/cm3 |
|---|---|
| Boiling Point | 583.9ºC at 760mmHg |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.57100 |
| Flash Point | 321ºC |
| Exact Mass | 408.28800 |
| PSA | 97.99000 |
| LogP | 3.44870 |
| InChIKey | BHQCQFFYRZLCQQ-UTLSPDKDSA-N |
| SMILES | CC(CCC(=O)O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C |
| Storage condition | 2-8℃ |
| 3-Epicholic acid |
| 3|A-Cholic Acid |
| 3|A,7|A,12|A-Trihydroxy-5|A-cholanoic Acid |