(4-chlorophenyl) 4-methoxybenzoate
(4-chlorophenyl) 4-methoxybenzoate structure
|
Common Name | (4-chlorophenyl) 4-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 29558-84-7 | Molecular Weight | 262.68800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (4-chlorophenyl) 4-methoxybenzoate, Chinese name not provided, CAS number 29558-84-7, molecular formula C14H11ClO3, molecular weight 262.68800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-chlorophenyl) 4-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H11ClO3 |
|---|---|
| Molecular Weight | 262.68800 |
| Exact Mass | 262.04000 |
| PSA | 35.53000 |
| LogP | 3.56780 |
| InChIKey | NUUGTSDUQSAQIU-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)Oc2ccc(Cl)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 2 | |
CAS#:2005-08-5
CAS#:62066-32-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p-Anisic acid,4-chlorophenyl ester |
| Benzoic acid,4-methoxy-,4-chlorophenyl ester |
| 4-chlorophenyl 4-methoxybenzoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (4-chlorophenyl) 4-methoxybenzoate? |
| A: The English name of (4-chlorophenyl) 4-methoxybenzoate is (4-chlorophenyl) 4-methoxybenzoate. |
| Q: What is the molecular formula of (4-chlorophenyl) 4-methoxybenzoate? |
| A: Molecular formula of (4-chlorophenyl) 4-methoxybenzoate is C14H11ClO3. |
| Q: What are the downstream products of (4-chlorophenyl) 4-methoxybenzoate? |
| A: Related downstream products(CAS) of (4-chlorophenyl) 4-methoxybenzoate: 2005-08-5;62066-32-4. |
| Q: What is the molecular weight of (4-chlorophenyl) 4-methoxybenzoate? |
| A: Molecular weight of (4-chlorophenyl) 4-methoxybenzoate is 262.68800. |
| Q: What is the LogP of (4-chlorophenyl) 4-methoxybenzoate? |
| A: LogP of (4-chlorophenyl) 4-methoxybenzoate is 3.56780. |
| Q: What English synonyms does (4-chlorophenyl) 4-methoxybenzoate have? |
| A: English synonyms of (4-chlorophenyl) 4-methoxybenzoate: p-Anisic acid,4-chlorophenyl ester, Benzoic acid,4-methoxy-,4-chlorophenyl ester, 4-chlorophenyl 4-methoxybenzoate. |
| Q: What is the CAS number of (4-chlorophenyl) 4-methoxybenzoate? |
| A: CAS number of (4-chlorophenyl) 4-methoxybenzoate is 29558-84-7. |
| Q: What is the SMILES notation of (4-chlorophenyl) 4-methoxybenzoate? |
| A: SMILES notation of (4-chlorophenyl) 4-methoxybenzoate is COc1ccc(C(=O)Oc2ccc(Cl)cc2)cc1. |
| Q: What are the upstream materials of (4-chlorophenyl) 4-methoxybenzoate? |
| A: Related upstream materials(CAS) of (4-chlorophenyl) 4-methoxybenzoate: 106-48-9;100-07-2;1679-18-1;123-11-5;7464-46-2;100-09-4;701-53-1;24573-38-4. |
| Q: What is the Chinese name of 29558-84-7? |
| A: Chinese name of 29558-84-7 is 29558-84-7. |