Methyl 4-trifluoromethylbenzoate structure
|
Common Name | Methyl 4-trifluoromethylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 2967-66-0 | Molecular Weight | 204.146 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 199.2±0.0 °C at 760 mmHg | |
| Molecular Formula | C9H7F3O2 | Melting Point | 13-14 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 82.2±0.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | methyl 4-(trifluoromethyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 199.2±0.0 °C at 760 mmHg |
| Melting Point | 13-14 °C(lit.) |
| Molecular Formula | C9H7F3O2 |
| Molecular Weight | 204.146 |
| Flash Point | 82.2±0.0 °C |
| Exact Mass | 204.039810 |
| PSA | 26.30000 |
| LogP | 3.17 |
| Vapour Pressure | 0.3±0.3 mmHg at 25°C |
| Index of Refraction | 1.447 |
| InChIKey | VAZWXPJOOFSNLB-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(F)(F)F)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2916399090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Silane/ MoO2Cl2 as an efficient system for the reduction of esters. Fernandes AC and Romão CC.
J. Mol. Catal. A: Chem. 253(1) , 96-98, (2006)
|
| Methyl 4-trifluoromethylbenzoate |
| 4-trifluoromethylbenzoic acid methyl ester |
| 4-(Trifluoromethyl)benzoic Acid Methyl Ester |
| Methyl α,α,α-Trifluoro-p-toluate |
| methyl-4-(trifluoromethyl)benzoate |
| Benzoic acid, 4-(trifluoromethyl)-, methyl ester |
| methyl p-(trifluoromethyl)benzoate |
| methyl 4-(trifluoromethyl)-1-benzoate |
| Methyl 4-(trifluoromethyl)benzoate |
| 4-CF3-C6H4-CO2Me |
| MFCD00042324 |