Benzenesulfonamide,4-[2-(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)diazenyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)- structure
|
Common Name | Benzenesulfonamide,4-[2-(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)diazenyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)- | ||
|---|---|---|---|---|
| CAS Number | 29822-02-4 | Molecular Weight | 455.51300 | |
| Density | 1.55g/cm3 | Boiling Point | 689.5ºC at 760mmHg | |
| Molecular Formula | C19H17N7O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 370.8ºC | |
| Name | 4-[(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)diazenyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
|---|
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 689.5ºC at 760mmHg |
| Molecular Formula | C19H17N7O3S2 |
| Molecular Weight | 455.51300 |
| Flash Point | 370.8ºC |
| Exact Mass | 455.08300 |
| PSA | 165.96000 |
| LogP | 4.17670 |
| Vapour Pressure | 7.27E-19mmHg at 25°C |
| Index of Refraction | 1.755 |
| InChIKey | YELXRFXLPAPXNK-UHFFFAOYSA-N |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1N=Nc1ccc(S(=O)(=O)Nc2nnc(C)s2)cc1 |
|
~%
Benzenesulfonam... CAS#:29822-02-4 |
| Literature: Harmon; Geller; Gupta; Herbert; Chitharanjan Journal of pharmaceutical sciences, 1970 , vol. 59, # 7 p. 1031 - 1033 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |