2-(3-bromophenyl)quinoline-4-carboxylic acid structure
|
Common Name | 2-(3-bromophenyl)quinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 298230-83-8 | Molecular Weight | 328.16000 | |
| Density | 1.556g/cm3 | Boiling Point | 487.8ºC at 760mmHg | |
| Molecular Formula | C16H10BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.8ºC | |
| Name | 2-(3-bromophenyl)quinoline-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.556g/cm3 |
|---|---|
| Boiling Point | 487.8ºC at 760mmHg |
| Molecular Formula | C16H10BrNO2 |
| Molecular Weight | 328.16000 |
| Flash Point | 248.8ºC |
| Exact Mass | 326.98900 |
| PSA | 50.19000 |
| LogP | 4.36250 |
| Vapour Pressure | 2.49E-10mmHg at 25°C |
| Index of Refraction | 1.699 |
| InChIKey | KBIDGMKRLPPRNG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2cccc(Br)c2)nc2ccccc12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933499090 |
|
~%
2-(3-bromopheny... CAS#:298230-83-8 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 14, # 7 p. 2209 - 2224 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00687529 |