N-(propanoylsulfamoyl)propanamide structure
|
Common Name | N-(propanoylsulfamoyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 29824-69-9 | Molecular Weight | 208.23500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H12N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(propanoylsulfamoyl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H12N2O4S |
|---|---|
| Molecular Weight | 208.23500 |
| Exact Mass | 208.05200 |
| PSA | 107.70000 |
| LogP | 2.04500 |
| InChIKey | CGGWQBLSJSLLLY-UHFFFAOYSA-N |
| SMILES | CCC(=O)NS(=O)(=O)NC(=O)CC |
|
~%
N-(propanoylsul... CAS#:29824-69-9 |
| Literature: Anderson; Degering Proceedings of the Indiana Academy of Science, 1946 , vol. 56, p. 134 Chem.Abstr., 1948 , p. 2588 |
|
~%
N-(propanoylsul... CAS#:29824-69-9 |
| Literature: Hobson, David W.; Helton, Danny O. Patent: US7005549 B2, 2006 ; Location in patent: Page/Page column 4 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| N,N'-dipropionyl-sulfamide |
| dipropionyl sulfamide |
| Propanamide,N,N'-sulfonylbis |