3-Indoleacrylic acid structure
|
Common Name | 3-Indoleacrylic acid | ||
|---|---|---|---|---|
| CAS Number | 29953-71-7 | Molecular Weight | 187.195 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 432.8±20.0 °C at 760 mmHg | |
| Molecular Formula | C11H9NO2 | Melting Point | 185 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 215.6±21.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | trans-3-Indoleacrylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 432.8±20.0 °C at 760 mmHg |
| Melting Point | 185 °C (dec.)(lit.) |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.195 |
| Flash Point | 215.6±21.8 °C |
| Exact Mass | 187.063324 |
| PSA | 53.09000 |
| LogP | 2.34 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.750 |
| InChIKey | PLVPPLCLBIEYEA-AATRIKPKSA-N |
| SMILES | O=C(O)C=Cc1c[nH]c2ccccc12 |
| Water Solubility | freely soluble |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | NL3680000 |
|
Tryptophan 2,3-dioxygenase (TDO) inhibitors. 3-(2-(pyridyl)ethenyl)indoles as potential anticancer immunomodulators.
J. Med. Chem. 54 , 5320, (2011) Tryptophan catabolism mediated by indoleamine 2,3-dioxygenase (IDO) is an important mechanism of peripheral immune tolerance contributing to tumoral immune resistance. IDO inhibition is thus an active... |
|
|
Structural insight into the inhibition of human kynurenine aminotransferase I/glutamine transaminase K.
J. Med. Chem. 52 , 2786-93, (2009) Human kynurenine aminotransferase I (hKAT I) catalyzes the formation of kynurenic acid, a neuroactive compound. Here, we report three high-resolution crystal structures (1.50-1.55 A) of hKAT I that ar... |
|
|
Glycodendrimers and Modified ELISAs: Tools to Elucidate Multivalent Interactions of Galectins 1 and 3.
Molecules 20 , 7059-96, (2015) Multivalent protein-carbohydrate interactions that are mediated by sugar-binding proteins, i.e., lectins, have been implicated in a myriad of intercellular recognition processes associated with tumor ... |
| 3-Indoleacrylic acid |
| (E)-3-(indol-3-yl)acrylic acid |
| 2-Propenoic acid, 3-(1H-indol-3-yl)-, (2E)- |
| INDOLE ACRYLIC ACID |
| INDOLE-3-ACRYLIC ACID |
| 2-Propenoic acid, 3- (1H-indol-3-yl)- |
| Indole-3-butyic acid |
| 3-(3-INDOLYL)ACRYLIC ACID |
| (2E)-3-(1H-Indol-3-yl)acrylic acid |
| trans-Indole-3-acrylic acid |
| (2E)-3-(1H-indol-3-yl)prop-2-enoic acid |
| Indole-3-crylic acid |
| Trans-3-Indoleacrylicn |
| EINECS 214-872-7 |
| MFCD00005633 |
| RARECHEM BK HD 0025 |