4-Nitrophenylethylamine hydrochloride structure
|
Common Name | 4-Nitrophenylethylamine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 29968-78-3 | Molecular Weight | 202.638 | |
| Density | 1.206g/cm3 | Boiling Point | 307.2ºC at 760 mmHg | |
| Molecular Formula | C8H11ClN2O2 | Melting Point | 200 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 139.6ºC | |
| Name | 2-(4-nitrophenyl)ethanamine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.206g/cm3 |
|---|---|
| Boiling Point | 307.2ºC at 760 mmHg |
| Melting Point | 200 °C (dec.)(lit.) |
| Molecular Formula | C8H11ClN2O2 |
| Molecular Weight | 202.638 |
| Flash Point | 139.6ºC |
| Exact Mass | 202.050903 |
| PSA | 71.84000 |
| LogP | 3.12150 |
| Vapour Pressure | 0.000737mmHg at 25°C |
| InChIKey | JVMHULJEYUQYSH-UHFFFAOYSA-N |
| SMILES | Cl.NCCc1ccc([N+](=O)[O-])cc1 |
| Storage condition | 0-6°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2921499090 |
|
~%
4-Nitrophenylet... CAS#:29968-78-3 |
| Literature: Journal of the American Chemical Society, , vol. 105, # 2 p. 265 - 279 |
|
~%
4-Nitrophenylet... CAS#:29968-78-3 |
| Literature: Recueil des Travaux Chimiques des Pays-Bas, , vol. 111, # 1 p. 22 - 28 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
N-(4-Nitro-pheneth-yl)formamide.
Acta Crystallogr. Sect. E Struct. Rep. Online 66(7) , o1721, (2010) The title compound, C(9)H(10)N(2)O(3), was synthesized by direct N-formyl-ation of 4-nitro-phenethyl-amine hydro-chloride with formic acid and sodium formate in the absence of catalyst and solvent. In... |
|
|
Ortho-metalated primary amines. 6.1 The first synthesis of six-membered palladacycles from primary amines containing electron-withdrawing substituents: end of the limiting rules of Cope and Friedrich on cyclopalladation of benzyl-and phenethylamines. Vicente J, et al.
Organometallics 22(26) , 5513-17, (2003)
|
| 2-(3,4-DIFLUOROPHENOXY)-4-METHYLANILINE |
| 4-Nitrophenethylamine hydrochloride |
| Benzeneethanamine, 4-nitro-, hydrochloride (1:1) |
| p-nitrophenethylamine hydrochloride |
| 1-(2-aminoethyl)-4-nitrobenzene hydrochloride |
| 4-Nitrophenylethylamine hydrochloride |
| 2-(4-Nitrophenyl)ethanamine hydrochloride (1:1) |
| MFCD00012900 |
| 4-Nitrophenethylamine HCl |
| EINECS 249-980-3 |
| 2-(4-nitro-phenyl)-ethylamine hydrochloride salt |
| 2-(4-Nitrophenyl)ethylamine Hydrochloride |
| p-Nitrophenethylamine, hydrochloride |
| 2-(4-nitrophenyl)ethanamine hydrochloride |