Benzeneethanamine,N,N-dimethyl-4-nitro structure
|
Common Name | Benzeneethanamine,N,N-dimethyl-4-nitro | ||
|---|---|---|---|---|
| CAS Number | 5339-05-9 | Molecular Weight | 194.23000 | |
| Density | 1.113g/cm3 | Boiling Point | 301.8ºC at 760 mmHg | |
| Molecular Formula | C10H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.3ºC | |
| Name | n,n-dimethyl-p-nitrophenethylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.113g/cm3 |
|---|---|
| Boiling Point | 301.8ºC at 760 mmHg |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23000 |
| Flash Point | 136.3ºC |
| Exact Mass | 194.10600 |
| PSA | 49.06000 |
| LogP | 2.22210 |
| Index of Refraction | 1.547 |
| InChIKey | QRJSXWJAUQIENU-UHFFFAOYSA-N |
| SMILES | CN(C)CCC1=CC=C(C=C1)[N+](=O)[O-] |
| HS Code | 2921499090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 5 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| N1,N1-Dimethyl-4-nitro-m-phenylendiamin |
| 3-amino-4-nitro-N,N-dimethylaniline |
| Dimethyl-(4-nitro-phenaethyl)-amin |
| N,N-dimethyl-4-nitrobutyramide |
| dimethyl-(4-nitro-phenethyl)-amine |
| N1,N1-dimethyl-4-nitro-m-phenylenediamine |
| 2-nitro-5-(dimethylamino)aniline |
| N,N-Dimethyl-4-nitrobutyramid |
| N,N-dimethyl-4-nitrophenylethylamine |
| 3-amino-4-nitrodimethylaminobenzene |
| N,N-dimethyl-2-(4-nitrophenyl)ethanamine |
| N,N-dimethyl-4-nitro-m-phenylenediamine |
| N,N-dimethyl-N-[2-(4-nitrophenyl)ethyl]amine |
| N,N-dimethyl-4-nitro-butanamide |
| 5-(dimethylamino)-2-nitroaniline |