Benzeneethanamine,N,N-dimethyl-4-nitro
Benzeneethanamine,N,N-dimethyl-4-nitro structure
|
Common Name | Benzeneethanamine,N,N-dimethyl-4-nitro | ||
|---|---|---|---|---|
| CAS Number | 5339-05-9 | Molecular Weight | 194.23000 | |
| Density | 1.113g/cm3 | Boiling Point | 301.8ºC at 760 mmHg | |
| Molecular Formula | C10H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.3ºC | |
Summary: n,n-Dimethyl-p-nitrophenethylamine (Chinese name: N,N-dimethyl-4-nitrobenzeneethanamine), CAS number: 5339-05-9, molecular formula: C10H14N2O2, molecular weight: 194.23000. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | n,n-dimethyl-p-nitrophenethylamine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.113g/cm3 |
|---|---|
| Boiling Point | 301.8ºC at 760 mmHg |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23000 |
| Flash Point | 136.3ºC |
| Exact Mass | 194.10600 |
| PSA | 49.06000 |
| LogP | 2.22210 |
| Index of Refraction | 1.547 |
| InChIKey | QRJSXWJAUQIENU-UHFFFAOYSA-N |
| SMILES | CN(C)CCC1=CC=C(C=C1)[N+](=O)[O-] |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2921499090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 5 | |
CAS#:5339-26-4
CAS#:506-59-2
CAS#:124-40-3
CAS#:50-00-0
CAS#:24954-67-4
CAS#:937-31-5
CAS#:100-11-8
CAS#:1126-71-2
CAS#:539-15-1
CAS#:100-13-0
CAS#:62-23-7
CAS#:5636-52-2This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N1,N1-Dimethyl-4-nitro-m-phenylendiamin |
| 3-amino-4-nitro-N,N-dimethylaniline |
| Dimethyl-(4-nitro-phenaethyl)-amin |
| N,N-dimethyl-4-nitrobutyramide |
| dimethyl-(4-nitro-phenethyl)-amine |
| N1,N1-dimethyl-4-nitro-m-phenylenediamine |
| 2-nitro-5-(dimethylamino)aniline |
| N,N-Dimethyl-4-nitrobutyramid |
| N,N-dimethyl-4-nitrophenylethylamine |
| 3-amino-4-nitrodimethylaminobenzene |
| N,N-dimethyl-2-(4-nitrophenyl)ethanamine |
| N,N-dimethyl-4-nitro-m-phenylenediamine |
| N,N-dimethyl-N-[2-(4-nitrophenyl)ethyl]amine |
| N,N-dimethyl-4-nitro-butanamide |
| 5-(dimethylamino)-2-nitroaniline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of n,n-dimethyl-p-nitrophenethylamine? |
| A: Related downstream products(CAS) of n,n-dimethyl-p-nitrophenethylamine: 539-15-1;100-13-0;1126-71-2;62-23-7;5636-52-2. |
| Q: What is the molecular formula of n,n-dimethyl-p-nitrophenethylamine? |
| A: Molecular formula of n,n-dimethyl-p-nitrophenethylamine is C10H14N2O2. |
| Q: What is the polar surface area (PSA) of n,n-dimethyl-p-nitrophenethylamine? |
| A: Polar surface area (PSA) of n,n-dimethyl-p-nitrophenethylamine is 49.06000. |
| Q: What is the SMILES notation of n,n-dimethyl-p-nitrophenethylamine? |
| A: SMILES notation of n,n-dimethyl-p-nitrophenethylamine is CN(C)CCC1=CC=C(C=C1)[N+](=O)[O-]. |
| Q: What is the molecular weight of n,n-dimethyl-p-nitrophenethylamine? |
| A: Molecular weight of n,n-dimethyl-p-nitrophenethylamine is 194.23000. |
| Q: What is the English name of n,n-dimethyl-p-nitrophenethylamine? |
| A: The English name of n,n-dimethyl-p-nitrophenethylamine is n,n-dimethyl-p-nitrophenethylamine. |
| Q: What is the CAS number of n,n-dimethyl-p-nitrophenethylamine? |
| A: CAS number of n,n-dimethyl-p-nitrophenethylamine is 5339-05-9. |
| Q: What is the boiling point of n,n-dimethyl-p-nitrophenethylamine? |
| A: Boiling point of n,n-dimethyl-p-nitrophenethylamine is 301.8ºC at 760 mmHg. |
| Q: What is the Chinese name of 5339-05-9? |
| A: Chinese name of 5339-05-9 is 5339-05-9. |
| Q: What are the upstream materials of n,n-dimethyl-p-nitrophenethylamine? |
| A: Related upstream materials(CAS) of n,n-dimethyl-p-nitrophenethylamine: 5339-26-4;506-59-2;124-40-3;50-00-0;24954-67-4;937-31-5;100-11-8;1126-71-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |