(4-tert-butylcyclohexylidene)bis[tert-butyl] peroxide structure
|
Common Name | (4-tert-butylcyclohexylidene)bis[tert-butyl] peroxide | ||
|---|---|---|---|---|
| CAS Number | 3007-19-0 | Molecular Weight | 316.47600 | |
| Density | 0.95g/cm3 | Boiling Point | 332.9ºC at 760mmHg | |
| Molecular Formula | C18H36O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117.6ºC | |
| Name | 4-tert-butyl-1,1-bis(tert-butylperoxy)cyclohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.95g/cm3 |
|---|---|
| Boiling Point | 332.9ºC at 760mmHg |
| Molecular Formula | C18H36O4 |
| Molecular Weight | 316.47600 |
| Flash Point | 117.6ºC |
| Exact Mass | 316.26100 |
| PSA | 36.92000 |
| LogP | 5.41240 |
| Index of Refraction | 1.454 |
| InChIKey | MBQBCEOICFPWKQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OOC1(OOC(C)(C)C)CCC(C(C)(C)C)CC1 |
| HS Code | 2909600000 |
|---|
|
~82%
(4-tert-butylcy... CAS#:3007-19-0 |
| Literature: Zmitek, Katja; Zupan, Marko; Stavber, Stojan; Iskra, Jernej Journal of Organic Chemistry, 2007 , vol. 72, # 17 p. 6534 - 6540 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909600000 |
|---|---|
| Summary | 2909600000 alcohol peroxides, ether peroxides, ketone peroxides and their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| einecs 221-113-3 |