WAY-278559-A structure
|
Common Name | WAY-278559-A | ||
|---|---|---|---|---|
| CAS Number | 301330-81-4 | Molecular Weight | 285.38402 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 455.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H23N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.4±28.7 °C | |
Use of WAY-278559-Aethanolamine kinase inhibitors |
| Name | WAY-278559-A |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 455.7±45.0 °C at 760 mmHg |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.38402 |
| Flash Point | 229.4±28.7 °C |
| Exact Mass | 285.184113 |
| LogP | 3.53 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | MNHUPYMQGWNISM-UHFFFAOYSA-N |
| SMILES | CCN1CCN(c2cc(C)c3ccc(OC)cc3n2)CC1 |
| 2-(4-Ethyl-piperazin-1-yl)-7-methoxy-4-methyl-quinoline |
| Quinoline, 2-(4-ethyl-1-piperazinyl)-7-methoxy-4-methyl- |
| 2-(4-Ethylpiperazin-1-yl)-7-methoxy-4-methylquinoline |
| 2-(4-Ethyl-1-piperazinyl)-7-methoxy-4-methylquinoline |