2,2-Bis(3,4-dimethylphenyl)hexafluoropropane structure
|
Common Name | 2,2-Bis(3,4-dimethylphenyl)hexafluoropropane | ||
|---|---|---|---|---|
| CAS Number | 65294-20-4 | Molecular Weight | 360.33700 | |
| Density | 1.198 g/cm3 | Boiling Point | 110-120°C 2mm | |
| Molecular Formula | C19H18F6 | Melting Point | 76-78°C | |
| MSDS | N/A | Flash Point | >110°C | |
| Name | 2,2-Bis(3,4-dimethylphenyl)hexafluoropropane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.198 g/cm3 |
|---|---|
| Boiling Point | 110-120°C 2mm |
| Melting Point | 76-78°C |
| Molecular Formula | C19H18F6 |
| Molecular Weight | 360.33700 |
| Flash Point | >110°C |
| Exact Mass | 360.13100 |
| LogP | 6.33090 |
| Index of Refraction | 1.589 |
| InChIKey | GLFKFHJEFMLTOB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(c2ccc(C)c(C)c2)(C(F)(F)F)C(F)(F)F)cc1C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Safety Phrases | S22-S24/25 |
| HS Code | 2903999090 |
|
~69%
2,2-Bis(3,4-dim... CAS#:65294-20-4 |
| Literature: Zhu, Shi-Zheng; Zhao, Jing-Wei; Zhang, Yun-Xiang Journal of Fluorine Chemistry, 2003 , vol. 123, # 2 p. 221 - 225 |
|
~%
2,2-Bis(3,4-dim... CAS#:65294-20-4 |
| Literature: Journal of Fluorine Chemistry, , vol. 54, # 1-3 p. 92 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD00042167 |
| 4-[2-(3,4-dimethylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-1,2-dimethylbenzene |
| EINECS 265-687-3 |