Hydroxyprogesterone acetate
Modify Date: 2026-07-01 17:31:49
Hydroxyprogesterone acetate structure
|
Common Name | Hydroxyprogesterone acetate | ||
|---|---|---|---|---|
| CAS Number | 302-23-8 | Molecular Weight | 372.498 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 494.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C23H32O4 | Melting Point | 249-250ºC | |
| MSDS | N/A | Flash Point | 213.5±28.8 °C | |
| Symbol |
GHS08 |
Signal Word | Warning | |
Use of Hydroxyprogesterone acetate17α-Hydroxyprogesterone acetate possesses progestational activity. 17α-Hydroxyprogesterone acetate has antiinflammatory effects at the murine maternal-fetal interface[1][2]. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Progesterone Acetate |
|---|---|
| Synonym | More Synonyms |
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | 17α-Hydroxyprogesterone acetate possesses progestational activity. 17α-Hydroxyprogesterone acetate has antiinflammatory effects at the murine maternal-fetal interface[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | 17α-Hydroxyprogesterone (Delalutin) is not androgenic, and that it, like progesterone and certain other sex steroids, does not alter the development of nonreproductive organs[1]. |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 494.3±45.0 °C at 760 mmHg |
| Melting Point | 249-250ºC |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.498 |
| Flash Point | 213.5±28.8 °C |
| Exact Mass | 372.230072 |
| PSA | 60.44000 |
| LogP | 3.41 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | VTHUYJIXSMGYOQ-KOORYGTMSA-N |
| SMILES | CC(=O)OC1(C(C)=O)CCC2C3CCC4=CC(=O)CCC4(C)C3CCC21C |
| Storage condition | Refrigerator |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS08 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H351 |
| Precautionary Statements | P280 |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R40 |
| Safety Phrases | 22-24/25-45 |
| RIDADR | UN 2811 6 |
| WGK Germany | 3 |
| RTECS | TU5074000 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 17-Acetoxyprogesterone |
| 17α-Acetoxyprogesterone |
| 3,20-Dioxopregn-4-en-17-yl acetate |
| 17a-Hydroxy-progesterone acetate |
| 17ALPHA-ACETOXYPROGESTERONE |
| Prodox acetate |
| 17α-Hydroxy-4-pregnene-3,20-dione 17-acetate |
| Chlormadinone acetate impurity G |
| 17-Hydroxypregn-4-ene-3,20-dione acetate |
| EINECS 206-119-6 |
| 17-(Acetyloxy)pregn-4-ene-3,20-dione |
| Pregn-4-ene-3,20-dione, 17-hydroxy-, acetate |
| Hydroxyprogesterone acetate |
| Acetoxyprogesterone |
| ProgesteroneAcetate |
| 3,20-Dioxopregn-4-en-1-yl acetate |
| 17-Hydroxyprogesterone 17α-acetate |
| 4-Pregnen-17α-ol-3,20-dione acetate |
| MFCD00021156 |
| 17-Hydroxyprogesterone acetate |
| 17α-Acetoxy-4-pregnene-3,20-dione |
| 17α-Acetoxy-4-pregnene-3,20-dione |
| 17a-Hydroxyprogesterone Acetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Progesterone Acetate? |
| A: CAS number of Progesterone Acetate is 302-23-8. |
| Q: What is the molecular weight of Progesterone Acetate? |
| A: Molecular weight of Progesterone Acetate is 372.498. |
| Q: What is the molecular formula of Progesterone Acetate? |
| A: Molecular formula of Progesterone Acetate is C23H32O4. |
| Q: What is the melting point of Progesterone Acetate? |
| A: Melting point of Progesterone Acetate is 249-250ºC. |
| Q: What is the safety information for Progesterone Acetate? |
| A: Safety information for Progesterone Acetate: 22-24/25-45. |
| Q: What is the English name of Progesterone Acetate? |
| A: The English name of Progesterone Acetate is Progesterone Acetate. |
| Q: What is the SMILES notation of Progesterone Acetate? |
| A: SMILES notation of Progesterone Acetate is CC(=O)OC1(C(C)=O)CCC2C3CCC4=CC(=O)CCC4(C)C3CCC21C. |
| Q: What are the storage conditions for Progesterone Acetate? |
| A: Storage conditions for Progesterone Acetate: Refrigerator. |
| Q: What is the polar surface area (PSA) of Progesterone Acetate? |
| A: Polar surface area (PSA) of Progesterone Acetate is 60.44000. |
| Q: What is the boiling point of Progesterone Acetate? |
| A: Boiling point of Progesterone Acetate is 494.3±45.0 °C at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |