3,3'-[Sulfonylbis(4,1-phenyleneoxy)]dianiline structure
|
Common Name | 3,3'-[Sulfonylbis(4,1-phenyleneoxy)]dianiline | ||
|---|---|---|---|---|
| CAS Number | 30203-11-3 | Molecular Weight | 432.492 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 648.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H20N2O4S | Melting Point | 132-135ºC | |
| MSDS | N/A | Flash Point | 346.1±30.1 °C | |
| Name | 3-[4-[4-(3-aminophenoxy)phenyl]sulfonylphenoxy]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 648.7±50.0 °C at 760 mmHg |
| Melting Point | 132-135ºC |
| Molecular Formula | C24H20N2O4S |
| Molecular Weight | 432.492 |
| Flash Point | 346.1±30.1 °C |
| Exact Mass | 432.114380 |
| PSA | 113.02000 |
| LogP | 4.44 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | WCXGOVYROJJXHA-UHFFFAOYSA-N |
| SMILES | Nc1cccc(Oc2ccc(S(=O)(=O)c3ccc(Oc4cccc(N)c4)cc3)cc2)c1 |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(4-([4-(3-Aminophenoxy)phenyl]sulfonyl)phenoxy)aniline |
| Bis[4-(3-aMinophenoxy)phenyl] Sulfone |
| 3,3'-(Sulfonylbis(4,1-phenyleneoxy))bisbenzenamine |
| EINECS 250-091-8 |
| MFCD00054738 |
| 3,3'-[Sulfonylbis(4,1-phenyleneoxy)]dianiline |
| 3,3'-((Sulfonylbis(4,1-phenylene))bis(oxy))dianiline |
| 3,3'-(Sulphonylbis(4,1-phenyleneoxy))dianiline |
| Benzenamine, 3,3'-[sulfonylbis(4,1-phenyleneoxy)]bis- |
| Benzenamine, 3,3'-(sulfonylbis(4,1-phenyleneoxy))bis- |