2-[2,5-bis(trifluoromethyl)phenyl]acetic acid structure
|
Common Name | 2-[2,5-bis(trifluoromethyl)phenyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 302912-02-3 | Molecular Weight | 272.14400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6F6O2 | Melting Point | 95-98 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-[2,5-bis(trifluoromethyl)phenyl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 95-98 °C(lit.) |
|---|---|
| Molecular Formula | C10H6F6O2 |
| Molecular Weight | 272.14400 |
| Exact Mass | 272.02700 |
| PSA | 37.30000 |
| LogP | 3.35130 |
| InChIKey | AWTNYFICBCCTBY-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cc(C(F)(F)F)ccc1C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2916399090 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Synthesis and Biological Evaluation of Fluorinated 3-Phenylcoumarin-7-O-Sulfamate Derivatives as Steroid Sulfatase Inhibitors.
Chem. Biol. Drug Des. 87 , 233-8, (2016) In the present work, we report the initial results of our study on a series of 3-phenylcoumarin sulfamate-based compounds containing C-F bonds as novel inhibitors of steroid sulfatase. The new compoun... |
| 2,4-DICHLORO-5-PYRIMIDINECARBONYL CHLORIDE |
| 2,5-Bis(trifluoromethyl)phenylacetic acid |
| MFCD01321246 |
| JRD-1680 |