1-BOC-4-BROMO-3-FORMYLINDOLE structure
|
Common Name | 1-BOC-4-BROMO-3-FORMYLINDOLE | ||
|---|---|---|---|---|
| CAS Number | 303041-88-5 | Molecular Weight | 324.17000 | |
| Density | 1.42g/cm3 | Boiling Point | 426.7ºC at 760mmHg | |
| Molecular Formula | C14H14BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.9ºC | |
| Name | tert-butyl 4-bromo-3-formylindole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 426.7ºC at 760mmHg |
| Molecular Formula | C14H14BrNO3 |
| Molecular Weight | 324.17000 |
| Flash Point | 211.9ºC |
| Exact Mass | 323.01600 |
| PSA | 48.30000 |
| LogP | 3.99950 |
| Index of Refraction | 1.585 |
| InChIKey | URXQJQRVBNAQDT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)n1cc(C=O)c2c(Br)cccc21 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
|
~83%
1-BOC-4-BROMO-3... CAS#:303041-88-5 |
| Literature: Davies, James R.; Kane, Peter D.; Moody, Christopher J. Journal of Organic Chemistry, 2005 , vol. 70, # 18 p. 7305 - 7316 |
|
~%
1-BOC-4-BROMO-3... CAS#:303041-88-5 |
| Literature: Organic Letters, , vol. 15, # 21 p. 5448 - 5451 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-bromo-1-tert-butoxycarbonylindole-3-carboxaldehyde |
| 4-Bromo-3-Formylindole-1-Carboxylic Acid Tert-Butyl Ester |
| OR1660 |
| 1-Boc-4-Bromo-3-formylindole |
| tert-butyl 4-bromo-3-formyl-1H-indole-1-carboxylate |
| N-Boc-4-bromoindole-3-carboxaldehyde |