1-Boc-4-Benzyloxy-3-formylindole structure
|
Common Name | 1-Boc-4-Benzyloxy-3-formylindole | ||
|---|---|---|---|---|
| CAS Number | 404888-01-3 | Molecular Weight | 351.39600 | |
| Density | 1.14g/cm3 | Boiling Point | 511.7ºC at 760mmHg | |
| Molecular Formula | C21H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.3ºC | |
| Name | 1-Boc-4-Benzyloxy-3-formylindole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 511.7ºC at 760mmHg |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.39600 |
| Flash Point | 263.3ºC |
| Exact Mass | 351.14700 |
| PSA | 57.53000 |
| LogP | 4.81600 |
| Index of Refraction | 1.568 |
| InChIKey | VGERAWRTLSARJZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)n1cc(C=O)c2c(OCc3ccccc3)cccc21 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 3-formyl-4-phenylmethoxyindole-1-carboxylate |