Dihydroxythiobinupharidine structure
|
Common Name | Dihydroxythiobinupharidine | ||
|---|---|---|---|---|
| CAS Number | 30343-70-5 | Molecular Weight | 526.73 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 667.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C30H42N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 357.4±31.5 °C | |
Use of Dihydroxythiobinupharidine6,6′-Dihydroxythiobinupharidine is a cysteine proteases inhibitor. 6,6′-Dihydroxythiobinupharidine can enhance DNA cleavage mediated by human topoisomerase IIα and IIβ ~8-fold and ~3-fold, respectively[1][2]. |
| Name | (+)-6,6'-dihydroxythiobinupharidine |
|---|---|
| Synonym | More Synonyms |
| Description | 6,6′-Dihydroxythiobinupharidine is a cysteine proteases inhibitor. 6,6′-Dihydroxythiobinupharidine can enhance DNA cleavage mediated by human topoisomerase IIα and IIβ ~8-fold and ~3-fold, respectively[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 667.3±55.0 °C at 760 mmHg |
| Molecular Formula | C30H42N2O4S |
| Molecular Weight | 526.73 |
| Flash Point | 357.4±31.5 °C |
| Exact Mass | 526.286499 |
| LogP | 4.57 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | DYEOLAMWQVWASS-QMARKCQSSA-N |
| SMILES | CC1CCC(c2ccoc2)N2C1CCC1(CSC3(CCC4C(C)CCC(c5ccoc5)N4C3O)C1)C2O |
| 6,6'-dihydroxythiobinupharidine |
| Dispiro[2H-quinolizine-3(4H),2'(3'H)-thiophene-4'(5'H),3''(4''H)-[2H]quinolizine]-4,4''-diol, 6,6''-di-3-furanyldodecahydro-9,9''-dimethyl-, (3S,4R,4'S,4''R,6S,6''S,9R,9''R,9aS,9a''S)- |
| (3S,4R,4'S,4''R,6S,6''S,9R,9''R,9aS,9a''S)-6,6''-Di(3-furyl)-9,9''-dimethyldodecahydro-2H,2''H-dispiro[quinolizine-3,2'-thiophene-4',3''-quinolizine]-4,4''-diol |
| (3S,4R,4'S,4''R,6S,6''S,9R,9''R,9aS,9a''S)-6,6''-di(furan-3-yl)-9,9''-dimethyldodecahydro-2H,2''H-dispiro[quinolizine-3,2'-thiophene-4',3''-quinolizine]-4,4''-diol |
| (+)-6,6'-dihydroxythiobinupharidine |