LU AA33810 structure
|
Common Name | LU AA33810 | ||
|---|---|---|---|---|
| CAS Number | 304008-29-5 | Molecular Weight | 423.61600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H25N3O2S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LU AA33810Lu AA33810 is a potent and selective antagonist of neuropeptide Y5 receptor with a Ki of 1.5 nM for the human receptor. Lu AA33810 exhibts antianxiolytic-like and antidepressant-like effects[1]. |
| Name | N-{[trans-4-(4,5-Dihydro[1]benzothiepino[5,4-d][1,3]thiazol-2-yla mino)cyclohexyl]methyl}methanesulfonamide |
|---|
| Description | Lu AA33810 is a potent and selective antagonist of neuropeptide Y5 receptor with a Ki of 1.5 nM for the human receptor. Lu AA33810 exhibts antianxiolytic-like and antidepressant-like effects[1]. |
|---|---|
| Related Catalog | |
| Target |
hY5 receptor:1.5 nM (Ki) |
| References |
| Molecular Formula | C19H25N3O2S3 |
|---|---|
| Molecular Weight | 423.61600 |
| Exact Mass | 423.11100 |
| PSA | 136.24000 |
| LogP | 4.87180 |
| InChIKey | UWSBTSAJZMIHBL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NCC1CCC(CC1)NC2=NC3=C(S2)CCSC4=CC=CC=C43 |