1-Cyclohepten-1-ol,2,6,6-trimethyl-, 1-acetate structure
|
Common Name | 1-Cyclohepten-1-ol,2,6,6-trimethyl-, 1-acetate | ||
|---|---|---|---|---|
| CAS Number | 30452-01-8 | Molecular Weight | 196.28600 | |
| Density | 0.95g/cm3 | Boiling Point | 266.4ºC at 760mmHg | |
| Molecular Formula | C12H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 105.6ºC | |
| Name | (2,6,6-trimethylcyclohepten-1-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.95g/cm3 |
|---|---|
| Boiling Point | 266.4ºC at 760mmHg |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.28600 |
| Flash Point | 105.6ºC |
| Exact Mass | 196.14600 |
| PSA | 26.30000 |
| LogP | 3.42370 |
| Index of Refraction | 1.467 |
| InChIKey | DOISGBZGBFUZQG-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C)CCCC(C)(C)C1 |
|
~%
1-Cyclohepten-1... CAS#:30452-01-8 |
| Literature: Wenkert,E. et al. Journal of the American Chemical Society, 1970 , vol. 92, p. 7428 - 7436 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Acetoxy-2,6,6-trimethylcyclohepten |
| 2,6,6-trimethylcyclohept-1-en-1-yl acetate |