BRD4-IN-4 structure
|
Common Name | BRD4-IN-4 | ||
|---|---|---|---|---|
| CAS Number | 304685-40-3 | Molecular Weight | 330.40 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 559.0±56.0 °C at 760 mmHg | |
| Molecular Formula | C17H18N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.8±31.8 °C | |
Use of BRD4-IN-4BRD4-IN-4 (Compound 1) is a BRD4 inhibitor (IC50=6.83 μM). BRD4-IN-4 selectively inhibits MV4-11 cell line proliferation and arrests cell at G1 phase. BRD4-IN-4 can be used for research of MLL leukemia[1]. |
| Name | WAY-383515 |
|---|---|
| Synonym | More Synonyms |
| Description | BRD4-IN-4 (Compound 1) is a BRD4 inhibitor (IC50=6.83 μM). BRD4-IN-4 selectively inhibits MV4-11 cell line proliferation and arrests cell at G1 phase. BRD4-IN-4 can be used for research of MLL leukemia[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 6.83 μM (BRD4)[1] |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 559.0±56.0 °C at 760 mmHg |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.40 |
| Flash Point | 291.8±31.8 °C |
| Exact Mass | 330.103821 |
| LogP | 1.80 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | HTONIJRZZRKKQF-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)c2cccc3c(S(=O)(=O)N4CCCC4)ccc1c23 |
| 1-ethyl-6-(pyrrolidin-1-ylsulfonyl)benzo[cd]indol-2(1H)-one |
| 1-Ethyl-6-(1-pyrrolidinylsulfonyl)benzo[cd]indol-2(1H)-one |
| 1-Ethyl-6-(pyrrolidine-1-sulfonyl)-1H-benzo[cd]indol-2-one |
| Benz[cd]indol-2(1H)-one, 1-ethyl-6-(1-pyrrolidinylsulfonyl)- |