WYE-176249 structure
|
Common Name | WYE-176249 | ||
|---|---|---|---|---|
| CAS Number | 304881-10-5 | Molecular Weight | 351.38 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 631.6±65.0 °C at 760 mmHg | |
| Molecular Formula | C19H13NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 335.8±34.3 °C | |
Use of WYE-176249VEGF inhibitor |
| Name | WYE-176249 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 631.6±65.0 °C at 760 mmHg |
| Molecular Formula | C19H13NO4S |
| Molecular Weight | 351.38 |
| Flash Point | 335.8±34.3 °C |
| Exact Mass | 351.056519 |
| LogP | 4.76 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | JKMMPUXYPPUPRJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2csc(-c3cc4ccc(O)cc4oc3=O)n2)cc1 |
| 2H-1-Benzopyran-2-one, 7-hydroxy-3-[4-(4-methoxyphenyl)-2-thiazolyl]- |
| MFCD01553627 |
| 7-Hydroxy-3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-2H-chromen-2-one |