4,5,6,7-tetrafluoroindole-3-carboxaldehyde structure
|
Common Name | 4,5,6,7-tetrafluoroindole-3-carboxaldehyde | ||
|---|---|---|---|---|
| CAS Number | 30683-38-6 | Molecular Weight | 217.12000 | |
| Density | 1.665g/cm3 | Boiling Point | 340.6ºC at 760mmHg | |
| Molecular Formula | C9H3F4NO | Melting Point | 234-236ºC | |
| MSDS | USA | Flash Point | 159.8ºC | |
| Name | 4,5,6,7-tetrafluoro-1H-indole-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.665g/cm3 |
|---|---|
| Boiling Point | 340.6ºC at 760mmHg |
| Melting Point | 234-236ºC |
| Molecular Formula | C9H3F4NO |
| Molecular Weight | 217.12000 |
| Flash Point | 159.8ºC |
| Exact Mass | 217.01500 |
| PSA | 32.86000 |
| LogP | 2.53680 |
| Index of Refraction | 1.61 |
| InChIKey | BHGCCJJOMNIVOA-UHFFFAOYSA-N |
| SMILES | O=Cc1c[nH]c2c(F)c(F)c(F)c(F)c12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933990090 |
| Precursor 8 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,5,6,7-tetrafluoro-indole-3-carbaldehyde |
| 4,5,6,7-tetrafluoro-1h-indole-3-carboxaldehyde |
| MFCD00236718 |
| 4,5,6,7-Tetrafluoroindole-3-Carboxaldehyde |
| 3-formyl-4,5,6,7-tetrafluoroindole |