(3,5,6-TRICHLORO-PYRIDIN-2-YL)-HYDRAZINE structure
|
Common Name | (3,5,6-TRICHLORO-PYRIDIN-2-YL)-HYDRAZINE | ||
|---|---|---|---|---|
| CAS Number | 306937-29-1 | Molecular Weight | 279.16100 | |
| Density | 1.246g/cm3 | Boiling Point | 398.8ºC at 760mmHg | |
| Molecular Formula | C15H12Cl2O | Melting Point | 55-58ºC | |
| MSDS | N/A | Flash Point | 168.6ºC | |
| Name | (3,5-dichlorophenyl)-(2,4-dimethylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 398.8ºC at 760mmHg |
| Melting Point | 55-58ºC |
| Molecular Formula | C15H12Cl2O |
| Molecular Weight | 279.16100 |
| Flash Point | 168.6ºC |
| Exact Mass | 278.02700 |
| PSA | 17.07000 |
| LogP | 4.84120 |
| Index of Refraction | 1.588 |
| InChIKey | SENBILWASAFEOD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)c2cc(Cl)cc(Cl)c2)c(C)c1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| MFCD00833417 |