PERFLUOROSEBACAMIDE
PERFLUOROSEBACAMIDE structure
|
Common Name | PERFLUOROSEBACAMIDE | ||
|---|---|---|---|---|
| CAS Number | 307-77-7 | Molecular Weight | 488.12500 | |
| Density | 1.726g/cm3 | Boiling Point | 344ºC at 760mmHg | |
| Molecular Formula | C10H4F16N2O2 | Melting Point | 233ºC | |
| MSDS | N/A | Flash Point | 161.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.726g/cm3 |
|---|---|
| Boiling Point | 344ºC at 760mmHg |
| Melting Point | 233ºC |
| Molecular Formula | C10H4F16N2O2 |
| Molecular Weight | 488.12500 |
| Flash Point | 161.9ºC |
| Exact Mass | 488.00200 |
| PSA | 86.18000 |
| LogP | 4.44000 |
| Index of Refraction | 1.331 |
| InChIKey | FWBPSSMCLDHZRS-UHFFFAOYSA-N |
| SMILES | NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(N)=O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2924199090 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 2 | |
CAS#:4590-24-3
CAS#:3492-12-4
CAS#:3799-53-9
CAS#:2342-09-8
CAS#:865-94-1This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Hexadecafluordecandiamid |
| Perfluorsebacinsaeure-diamid |
| hexadecafluorodecanediamide |
| Perfluorosebacamide |
| Perfluorosebacicdiamide |
| perfluorosebacic acid diamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide? |
| A: Polar surface area (PSA) of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide is 86.18000. |
| Q: What is the melting point of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide? |
| A: Melting point of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide is 233ºC. |
| Q: What English synonyms does 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide have? |
| A: English synonyms of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide: Hexadecafluordecandiamid, Perfluorsebacinsaeure-diamid, hexadecafluorodecanediamide, Perfluorosebacamide, Perfluorosebacicdiamide, perfluorosebacic acid diamide. |
| Q: What is the SMILES notation of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide? |
| A: SMILES notation of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide is NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(N)=O. |
| Q: What is the Chinese name of 307-77-7? |
| A: Chinese name of 307-77-7 is 307-77-7. |
| Q: What is the CAS number of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide? |
| A: CAS number of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide is 307-77-7. |
| Q: What are the upstream materials of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide? |
| A: Related upstream materials(CAS) of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide: 4590-24-3;3492-12-4;3799-53-9. |
| Q: What is the boiling point of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide? |
| A: Boiling point of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide is 344ºC at 760mmHg. |
| Q: What are the downstream products of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide? |
| A: Related downstream products(CAS) of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide: 2342-09-8;865-94-1. |
| Q: What is the InChIKey of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide? |
| A: InChIKey of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide is FWBPSSMCLDHZRS-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |