Dimethyl hexadecafluorosebacate structure
|
Common Name | Dimethyl hexadecafluorosebacate | ||
|---|---|---|---|---|
| CAS Number | 4590-24-3 | Molecular Weight | 518.14800 | |
| Density | 1.613g/cm3 | Boiling Point | 224.2ºC at 760mmHg | |
| Molecular Formula | C12H6F16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87ºC | |
| Name | Dimethyl hexadecafluorosebacate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.613g/cm3 |
|---|---|
| Boiling Point | 224.2ºC at 760mmHg |
| Molecular Formula | C12H6F16O4 |
| Molecular Weight | 518.14800 |
| Flash Point | 87ºC |
| Exact Mass | 518.00100 |
| PSA | 52.60000 |
| LogP | 4.41480 |
| Index of Refraction | 1.319 |
| InChIKey | VZHNQOSVLFDCLH-UHFFFAOYSA-N |
| SMILES | COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)OC |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2917190090 |
|
~%
Dimethyl hexade... CAS#:4590-24-3 |
| Literature: Szlavik, Zoltan; Csampai, Antal; Krafft, Marie Pierre; Riess, Jean G.; Rabai, Jozsef Tetrahedron Letters, 1997 , vol. 38, # 50 p. 8757 - 8760 |
|
~%
Dimethyl hexade... CAS#:4590-24-3 |
| Literature: Ward,R.B. Journal of Organic Chemistry, 1965 , vol. 30, p. 3009 - 3011 |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00236604 |
| dimethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanedioate |