Boc-Aib-OH structure
|
Common Name | Boc-Aib-OH | ||
|---|---|---|---|---|
| CAS Number | 30992-29-1 | Molecular Weight | 203.236 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 325.6±37.0 °C at 760 mmHg | |
| Molecular Formula | C9H17NO4 | Melting Point | 118-122 °C | |
| MSDS | Chinese USA | Flash Point | 150.7±26.5 °C | |
Use of Boc-Aib-OH2-((tert-Butoxycarbonyl)amino)-2-methylpropanoic acid is an alanine derivative[1]. |
| Name | 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 2-((tert-Butoxycarbonyl)amino)-2-methylpropanoic acid is an alanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 325.6±37.0 °C at 760 mmHg |
| Melting Point | 118-122 °C |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.236 |
| Flash Point | 150.7±26.5 °C |
| Exact Mass | 203.115753 |
| PSA | 75.63000 |
| LogP | 1.29 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.477 |
| InChIKey | MFNXWZGIFWJHMI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C(=O)O |
| Storage condition | 0-6°C |
| Precursor 9 | |
|---|---|
| DownStream 8 | |
|
Unraveling the interplay of backbone rigidity and electron rich side-chains on electron transfer in peptides: the realization of tunable molecular wires.
J. Am. Chem. Soc. 136(35) , 12479-88, (2014) Electrochemical studies are reported on a series of peptides constrained into either a 310-helix (1-6) or β-strand (7-9) conformation, with variable numbers of electron rich alkene containing side cha... |
|
|
W. Mayr, G. Jung
Liebigs Ann. Chem. (and reference cited therein) , 715, (1980)
|
| N-Boc-2-Aminoisobutanoic acid |
| Boc-Aib-OH |
| 2-(1,1-dimethylethoxycarbonyl)amino-2-methyl-propionic acid |
| BOC-α-Methylalanine |
| N-((1,1-Dimethylethoxy)carbonyl)-2-methyl-alanine |
| Aspartic acid, 2-methyl-, 4-(1,1-dimethylethyl) ester |
| N-Boc-2-methylalanine |
| 2-Amino-2-methyl-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid |
| 2-(tert-butoxycarbonyl)amino-2-methylpropanoic acid |
| α-(Boc-amino)isobutyric acid |
| 2-(tert-Butoxycarbonylamino)isobutyric Acid |
| N-(tert-butoxycarbonyl)-2-aminoisobutyric acid |
| 2-Methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}alanine |
| Boc-Alpha-Methylalanine |
| 2-tert-butoxycarbonylamino-2-methyl-propionic acid |
| Boc-2-aminoisobutyric acid |
| N-Boc-2-amino-2-methylpropanoic acid |
| 2-((tert-Butoxycarbonyl)amino)-2-methylpropanoic acid |
| 2-[(1,1-dimethylethoxy)carbonyl]amino-2-methyl-propanoic acid |
| N-Boc-α-methylalanine |
| 2-(Boc-amino)isobutyric Acid |
| N-Boc-2-aminoisobutyric acid |
| N-(tert-butoxycarbonyl)-2-methylalanine |
| EINECS 250-421-0 |
| MFCD00042973 |